C20H16F3N5O4 — CID 55784998
N-[2-methyl-5-(2,2,2-trifluoroethylcarbamoyl)phenyl]-1-(4-nitrophenyl)pyrazole-4-carboxamide (PubChem CID 55784998) has the molecular formula C20H16F3N5O4 and a molecular weight of 447.37 g/mol. Its IUPAC name is N-[2-methyl-5-(2,2,2-trifluoroethylcarbamoyl)phenyl]-1-(4-nitrophenyl)pyrazole-4-carboxamide.
| Compound Name | N-[2-methyl-5-(2,2,2-trifluoroethylcarbamoyl)phenyl]-1-(4-nitrophenyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 55784998 |
| Molecular Formula | C20H16F3N5O4 |
| Molecular Weight | 447.37 g/mol |
| Exact Mass | 447.12 |
| IUPAC Name | N-[2-methyl-5-(2,2,2-trifluoroethylcarbamoyl)phenyl]-1-(4-nitrophenyl)pyrazole-4-carboxamide |
| SMILES | Cc1ccc(C(=O)NCC(F)(F)F)cc1NC(=O)c1cnn(-c2ccc([N+](=O)[O-])cc2)c1 |
| InChI | InChI=1S/C20H16F3N5O4/c1-12-2-3-13(18(29)24-11-20(21,22)23)8-17(12)26-19(30)14-9-25-27(10-14)15-4-6-16(7-5-15)28(31)32/h2-10H,11H2,1H3,(H,24,29)(H,26,30) |
| InChIKey | KJGXCBAUMPUSDW-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 119.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.37 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|