C21H19N5OS — CID 55786551
N'-benzyl-2-(1-methylpyrazol-4-yl)-N'-phenyl-1,3-thiazole-4-carbohydrazide (PubChem CID 55786551) has the molecular formula C21H19N5OS and a molecular weight of 389.48 g/mol. Its IUPAC name is N'-benzyl-2-(1-methylpyrazol-4-yl)-N'-phenyl-1,3-thiazole-4-carbohydrazide.
| Compound Name | N'-benzyl-2-(1-methylpyrazol-4-yl)-N'-phenyl-1,3-thiazole-4-carbohydrazide |
|---|---|
| PubChem CID | 55786551 |
| Molecular Formula | C21H19N5OS |
| Molecular Weight | 389.48 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | N'-benzyl-2-(1-methylpyrazol-4-yl)-N'-phenyl-1,3-thiazole-4-carbohydrazide |
| SMILES | Cn1cc(-c2nc(C(=O)NN(Cc3ccccc3)c3ccccc3)cs2)cn1 |
| InChI | InChI=1S/C21H19N5OS/c1-25-14-17(12-22-25)21-23-19(15-28-21)20(27)24-26(18-10-6-3-7-11-18)13-16-8-4-2-5-9-16/h2-12,14-15H,13H2,1H3,(H,24,27) |
| InChIKey | MGAKFJKGWMRQJW-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.48 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|