C21H23N3O2S — CID 55787475
N-[(3-butoxyphenyl)methyl]-4-methyl-2-pyridin-2-yl-1,3-thiazole-5-carboxamide (PubChem CID 55787475) has the molecular formula C21H23N3O2S and a molecular weight of 381.50 g/mol. Its IUPAC name is N-[(3-butoxyphenyl)methyl]-4-methyl-2-pyridin-2-yl-1,3-thiazole-5-carboxamide.
| Compound Name | N-[(3-butoxyphenyl)methyl]-4-methyl-2-pyridin-2-yl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 55787475 |
| Molecular Formula | C21H23N3O2S |
| Molecular Weight | 381.50 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | N-[(3-butoxyphenyl)methyl]-4-methyl-2-pyridin-2-yl-1,3-thiazole-5-carboxamide |
| SMILES | CCCCOc1cccc(CNC(=O)c2sc(-c3ccccn3)nc2C)c1 |
| InChI | InChI=1S/C21H23N3O2S/c1-3-4-12-26-17-9-7-8-16(13-17)14-23-20(25)19-15(2)24-21(27-19)18-10-5-6-11-22-18/h5-11,13H,3-4,12,14H2,1-2H3,(H,23,25) |
| InChIKey | GJSOFMCGBYAMBP-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.50 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|