C23H25BrN4O3 — CID 55788652
1-(4-bromophenyl)-N'-[2-(2,3-dimethylphenoxy)propanoyl]-3,5-dimethylpyrazole-4-carbohydrazide (PubChem CID 55788652) has the molecular formula C23H25BrN4O3 and a molecular weight of 485.38 g/mol. Its IUPAC name is 1-(4-bromophenyl)-N'-[2-(2,3-dimethylphenoxy)propanoyl]-3,5-dimethylpyrazole-4-carbohydrazide.
| Compound Name | 1-(4-bromophenyl)-N'-[2-(2,3-dimethylphenoxy)propanoyl]-3,5-dimethylpyrazole-4-carbohydrazide |
|---|---|
| PubChem CID | 55788652 |
| Molecular Formula | C23H25BrN4O3 |
| Molecular Weight | 485.38 g/mol |
| Exact Mass | 484.11 |
| IUPAC Name | 1-(4-bromophenyl)-N'-[2-(2,3-dimethylphenoxy)propanoyl]-3,5-dimethylpyrazole-4-carbohydrazide |
| SMILES | Cc1cccc(OC(C)C(=O)NNC(=O)c2c(C)nn(-c3ccc(Br)cc3)c2C)c1C |
| InChI | InChI=1S/C23H25BrN4O3/c1-13-7-6-8-20(14(13)2)31-17(5)22(29)25-26-23(30)21-15(3)27-28(16(21)4)19-11-9-18(24)10-12-19/h6-12,17H,1-5H3,(H,25,29)(H,26,30) |
| InChIKey | MQBMYLAQTIINMA-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.38 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|