C17H15BrN4O3S — CID 55789132
5-bromo-N'-[4-[(1-methylimidazol-2-yl)methoxy]benzoyl]thiophene-2-carbohydrazide (PubChem CID 55789132) has the molecular formula C17H15BrN4O3S and a molecular weight of 435.30 g/mol. Its IUPAC name is 5-bromo-N'-[4-[(1-methylimidazol-2-yl)methoxy]benzoyl]thiophene-2-carbohydrazide.
| Compound Name | 5-bromo-N'-[4-[(1-methylimidazol-2-yl)methoxy]benzoyl]thiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 55789132 |
| Molecular Formula | C17H15BrN4O3S |
| Molecular Weight | 435.30 g/mol |
| Exact Mass | 434.00 |
| IUPAC Name | 5-bromo-N'-[4-[(1-methylimidazol-2-yl)methoxy]benzoyl]thiophene-2-carbohydrazide |
| SMILES | Cn1ccnc1COc1ccc(C(=O)NNC(=O)c2ccc(Br)s2)cc1 |
| InChI | InChI=1S/C17H15BrN4O3S/c1-22-9-8-19-15(22)10-25-12-4-2-11(3-5-12)16(23)20-21-17(24)13-6-7-14(18)26-13/h2-9H,10H2,1H3,(H,20,23)(H,21,24) |
| InChIKey | GICJJFDOJVOXAQ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.30 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|