C26H33N5O3 — CID 55790344
1-tert-butyl-6-cyclopropyl-N'-[2-(2,3-dimethylphenoxy)propanoyl]-3-methylpyrazolo[5,4-b]pyridine-4-carbohydrazide (PubChem CID 55790344) has the molecular formula C26H33N5O3 and a molecular weight of 463.58 g/mol. Its IUPAC name is 1-tert-butyl-6-cyclopropyl-N'-[2-(2,3-dimethylphenoxy)propanoyl]-3-methylpyrazolo[5,4-b]pyridine-4-carbohydrazide.
| Compound Name | 1-tert-butyl-6-cyclopropyl-N'-[2-(2,3-dimethylphenoxy)propanoyl]-3-methylpyrazolo[5,4-b]pyridine-4-carbohydrazide |
|---|---|
| PubChem CID | 55790344 |
| Molecular Formula | C26H33N5O3 |
| Molecular Weight | 463.58 g/mol |
| Exact Mass | 463.26 |
| IUPAC Name | 1-tert-butyl-6-cyclopropyl-N'-[2-(2,3-dimethylphenoxy)propanoyl]-3-methylpyrazolo[5,4-b]pyridine-4-carbohydrazide |
| SMILES | Cc1cccc(OC(C)C(=O)NNC(=O)c2cc(C3CC3)nc3c2c(C)nn3C(C)(C)C)c1C |
| InChI | InChI=1S/C26H33N5O3/c1-14-9-8-10-21(15(14)2)34-17(4)24(32)28-29-25(33)19-13-20(18-11-12-18)27-23-22(19)16(3)30-31(23)26(5,6)7/h8-10,13,17-18H,11-12H2,1-7H3,(H,28,32)(H,29,33) |
| InChIKey | PCOGPPXRSDKWPG-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 98.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.58 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|