C18H20ClN3O6S — CID 55792132
N'-(4-chloro-2-methoxybenzoyl)-5-methyl-4-pyrrolidin-1-ylsulfonylfuran-2-carbohydrazide (PubChem CID 55792132) has the molecular formula C18H20ClN3O6S and a molecular weight of 441.89 g/mol. Its IUPAC name is N'-(4-chloro-2-methoxybenzoyl)-5-methyl-4-pyrrolidin-1-ylsulfonylfuran-2-carbohydrazide.
| Compound Name | N'-(4-chloro-2-methoxybenzoyl)-5-methyl-4-pyrrolidin-1-ylsulfonylfuran-2-carbohydrazide |
|---|---|
| PubChem CID | 55792132 |
| Molecular Formula | C18H20ClN3O6S |
| Molecular Weight | 441.89 g/mol |
| Exact Mass | 441.08 |
| IUPAC Name | N'-(4-chloro-2-methoxybenzoyl)-5-methyl-4-pyrrolidin-1-ylsulfonylfuran-2-carbohydrazide |
| SMILES | COc1cc(Cl)ccc1C(=O)NNC(=O)c1cc(S(=O)(=O)N2CCCC2)c(C)o1 |
| InChI | InChI=1S/C18H20ClN3O6S/c1-11-16(29(25,26)22-7-3-4-8-22)10-15(28-11)18(24)21-20-17(23)13-6-5-12(19)9-14(13)27-2/h5-6,9-10H,3-4,7-8H2,1-2H3,(H,20,23)(H,21,24) |
| InChIKey | QHHKBBOHSBOBKF-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 117.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.89 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|