C17H18N4O3S — CID 55792234
N-[2-(3-methoxyphenoxy)ethyl]-2-(1-methylpyrazol-4-yl)-1,3-thiazole-4-carboxamide (PubChem CID 55792234) has the molecular formula C17H18N4O3S and a molecular weight of 358.42 g/mol. Its IUPAC name is N-[2-(3-methoxyphenoxy)ethyl]-2-(1-methylpyrazol-4-yl)-1,3-thiazole-4-carboxamide.
| Compound Name | N-[2-(3-methoxyphenoxy)ethyl]-2-(1-methylpyrazol-4-yl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 55792234 |
| Molecular Formula | C17H18N4O3S |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | N-[2-(3-methoxyphenoxy)ethyl]-2-(1-methylpyrazol-4-yl)-1,3-thiazole-4-carboxamide |
| SMILES | COc1cccc(OCCNC(=O)c2csc(-c3cnn(C)c3)n2)c1 |
| InChI | InChI=1S/C17H18N4O3S/c1-21-10-12(9-19-21)17-20-15(11-25-17)16(22)18-6-7-24-14-5-3-4-13(8-14)23-2/h3-5,8-11H,6-7H2,1-2H3,(H,18,22) |
| InChIKey | MZZVJGBFTMWERH-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|