C15H13Cl2FN2O3S — CID 55792661
N-(2,4-dichlorophenyl)-3-(dimethylsulfamoyl)-4-fluorobenzamide (PubChem CID 55792661) has the molecular formula C15H13Cl2FN2O3S and a molecular weight of 391.25 g/mol. Its IUPAC name is N-(2,4-dichlorophenyl)-3-(dimethylsulfamoyl)-4-fluorobenzamide.
| Compound Name | N-(2,4-dichlorophenyl)-3-(dimethylsulfamoyl)-4-fluorobenzamide |
|---|---|
| PubChem CID | 55792661 |
| Molecular Formula | C15H13Cl2FN2O3S |
| Molecular Weight | 391.25 g/mol |
| Exact Mass | 390.00 |
| IUPAC Name | N-(2,4-dichlorophenyl)-3-(dimethylsulfamoyl)-4-fluorobenzamide |
| SMILES | CN(C)S(=O)(=O)c1cc(C(=O)Nc2ccc(Cl)cc2Cl)ccc1F |
| InChI | InChI=1S/C15H13Cl2FN2O3S/c1-20(2)24(22,23)14-7-9(3-5-12(14)18)15(21)19-13-6-4-10(16)8-11(13)17/h3-8H,1-2H3,(H,19,21) |
| InChIKey | UYKMAICGDFCDLE-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.25 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |