C24H30N2O3 — CID 55794251
1-(3,5-dimethylbenzoyl)-N-[(3-ethoxyphenyl)methyl]piperidine-3-carboxamide (PubChem CID 55794251) has the molecular formula C24H30N2O3 and a molecular weight of 394.52 g/mol. Its IUPAC name is 1-(3,5-dimethylbenzoyl)-N-[(3-ethoxyphenyl)methyl]piperidine-3-carboxamide.
| Compound Name | 1-(3,5-dimethylbenzoyl)-N-[(3-ethoxyphenyl)methyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 55794251 |
| Molecular Formula | C24H30N2O3 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.23 |
| IUPAC Name | 1-(3,5-dimethylbenzoyl)-N-[(3-ethoxyphenyl)methyl]piperidine-3-carboxamide |
| SMILES | CCOc1cccc(CNC(=O)C2CCCN(C(=O)c3cc(C)cc(C)c3)C2)c1 |
| InChI | InChI=1S/C24H30N2O3/c1-4-29-22-9-5-7-19(14-22)15-25-23(27)20-8-6-10-26(16-20)24(28)21-12-17(2)11-18(3)13-21/h5,7,9,11-14,20H,4,6,8,10,15-16H2,1-3H3,(H,25,27) |
| InChIKey | WVHXEQABQQYSDN-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |