C20H23N7OS — CID 55799522
1-[(4-thiomorpholin-4-ylphenyl)methyl]-3-[[2-(1,2,4-triazol-1-yl)-3-pyridinyl]methyl]urea (PubChem CID 55799522) has the molecular formula C20H23N7OS and a molecular weight of 409.52 g/mol. Its IUPAC name is 1-[(4-thiomorpholin-4-ylphenyl)methyl]-3-[[2-(1,2,4-triazol-1-yl)-3-pyridinyl]methyl]urea.
| Compound Name | 1-[(4-thiomorpholin-4-ylphenyl)methyl]-3-[[2-(1,2,4-triazol-1-yl)-3-pyridinyl]methyl]urea |
|---|---|
| PubChem CID | 55799522 |
| Molecular Formula | C20H23N7OS |
| Molecular Weight | 409.52 g/mol |
| Exact Mass | 409.17 |
| IUPAC Name | 1-[(4-thiomorpholin-4-ylphenyl)methyl]-3-[[2-(1,2,4-triazol-1-yl)-3-pyridinyl]methyl]urea |
| SMILES | O=C(NCc1ccc(N2CCSCC2)cc1)NCc1cccnc1-n1cncn1 |
| InChI | InChI=1S/C20H23N7OS/c28-20(24-13-17-2-1-7-22-19(17)27-15-21-14-25-27)23-12-16-3-5-18(6-4-16)26-8-10-29-11-9-26/h1-7,14-15H,8-13H2,(H2,23,24,28) |
| InChIKey | YBGCSIPJGRTVAL-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 87.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.52 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|