C21H26N2O3 — CID 55799582
N-[1-(2,4-dimethoxyphenyl)ethyl]-2-phenylpyrrolidine-1-carboxamide (PubChem CID 55799582) has the molecular formula C21H26N2O3 and a molecular weight of 354.45 g/mol. Its IUPAC name is N-[1-(2,4-dimethoxyphenyl)ethyl]-2-phenylpyrrolidine-1-carboxamide.
| Compound Name | N-[1-(2,4-dimethoxyphenyl)ethyl]-2-phenylpyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 55799582 |
| Molecular Formula | C21H26N2O3 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | N-[1-(2,4-dimethoxyphenyl)ethyl]-2-phenylpyrrolidine-1-carboxamide |
| SMILES | COc1ccc(C(C)NC(=O)N2CCCC2c2ccccc2)c(OC)c1 |
| InChI | InChI=1S/C21H26N2O3/c1-15(18-12-11-17(25-2)14-20(18)26-3)22-21(24)23-13-7-10-19(23)16-8-5-4-6-9-16/h4-6,8-9,11-12,14-15,19H,7,10,13H2,1-3H3,(H,22,24) |
| InChIKey | DGTVSBRMZPRGSZ-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |