About N-[4-(2,6-dimethylmorpholin-4-yl)-3-fluorophenyl]-3-quinolin-8-ylprop-2-enamide
N-[4-(2,6-dimethylmorpholin-4-yl)-3-fluorophenyl]-3-quinolin-8-ylprop-2-enamide (PubChem CID 55799667) has the molecular formula C24H24FN3O2
and a molecular weight of 405.47 g/mol. Its IUPAC name is N-[4-(2,6-dimethylmorpholin-4-yl)-3-fluorophenyl]-3-quinolin-8-ylprop-2-enamide.
Molecular Properties
| Compound Name | N-[4-(2,6-dimethylmorpholin-4-yl)-3-fluorophenyl]-3-quinolin-8-ylprop-2-enamide |
| PubChem CID | 55799667 |
| Molecular Formula | C24H24FN3O2 |
| Molecular Weight | 405.47 g/mol |
| Exact Mass | 405.19 |
| IUPAC Name | N-[4-(2,6-dimethylmorpholin-4-yl)-3-fluorophenyl]-3-quinolin-8-ylprop-2-enamide |
| SMILES | CC1CN(c2ccc(NC(=O)C=Cc3cccc4cccnc34)cc2F)CC(C)O1 |
| InChI | InChI=1S/C24H24FN3O2/c1-16-14-28(15-17(2)30-16)22-10-9-20(13-21(22)25)27-23(29)11-8-19-6-3-5-18-7-4-12-26-24(18)19/h3-13,16-17H,14-15H2,1-2H3,(H,27,29) |
| InChIKey | VAWBICCTPVHOMC-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 405.47 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N-[4-(2,6-dimethylmorpholin-4-yl)-3-fluorophenyl]-3-quinolin-8-ylprop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-(2,6-dimethylmorpholin-4-yl)-3-fluorophenyl]-3-quinolin-8-ylprop-2-enamide?
The IUPAC name of N-[4-(2,6-dimethylmorpholin-4-yl)-3-fluorophenyl]-3-quinolin-8-ylprop-2-enamide (CID 55799667) is N-[4-(2,6-dimethylmorpholin-4-yl)-3-fluorophenyl]-3-quinolin-8-ylprop-2-enamide.
What is the SMILES notation for N-[4-(2,6-dimethylmorpholin-4-yl)-3-fluorophenyl]-3-quinolin-8-ylprop-2-enamide?
The canonical SMILES for N-[4-(2,6-dimethylmorpholin-4-yl)-3-fluorophenyl]-3-quinolin-8-ylprop-2-enamide is CC1CN(c2ccc(NC(=O)C=Cc3cccc4cccnc34)cc2F)CC(C)O1.
What is the InChIKey of N-[4-(2,6-dimethylmorpholin-4-yl)-3-fluorophenyl]-3-quinolin-8-ylprop-2-enamide?
The InChIKey is VAWBICCTPVHOMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H24FN3O2/c1-16-14-28(15-17(2)30-16)22-10-9-20(13-21(22)25)27-23(29)11-8-19-6-3-5-18-7-4-12-26-24(18)19/h3-13,16-17H,14-15H2,1-2H3,(H,27,29).
What are the key properties of N-[4-(2,6-dimethylmorpholin-4-yl)-3-fluorophenyl]-3-quinolin-8-ylprop-2-enamide?
N-[4-(2,6-dimethylmorpholin-4-yl)-3-fluorophenyl]-3-quinolin-8-ylprop-2-enamide has a molecular weight of 405.47 g/mol, XLogP of 4.64, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-(2,6-dimethylmorpholin-4-yl)-3-fluorophenyl]-3-quinolin-8-ylprop-2-enamide is sourced from PubChem (CID 55799667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).