C23H32N4O5S — CID 55800250
N-cyclopropyl-2-oxo-2-[4-[1-(2,4,6-trimethylphenyl)sulfonylpyrrolidine-2-carbonyl]piperazin-1-yl]acetamide (PubChem CID 55800250) has the molecular formula C23H32N4O5S and a molecular weight of 476.60 g/mol. Its IUPAC name is N-cyclopropyl-2-oxo-2-[4-[1-(2,4,6-trimethylphenyl)sulfonylpyrrolidine-2-carbonyl]piperazin-1-yl]acetamide.
| Compound Name | N-cyclopropyl-2-oxo-2-[4-[1-(2,4,6-trimethylphenyl)sulfonylpyrrolidine-2-carbonyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 55800250 |
| Molecular Formula | C23H32N4O5S |
| Molecular Weight | 476.60 g/mol |
| Exact Mass | 476.21 |
| IUPAC Name | N-cyclopropyl-2-oxo-2-[4-[1-(2,4,6-trimethylphenyl)sulfonylpyrrolidine-2-carbonyl]piperazin-1-yl]acetamide |
| SMILES | Cc1cc(C)c(S(=O)(=O)N2CCCC2C(=O)N2CCN(C(=O)C(=O)NC3CC3)CC2)c(C)c1 |
| InChI | InChI=1S/C23H32N4O5S/c1-15-13-16(2)20(17(3)14-15)33(31,32)27-8-4-5-19(27)22(29)25-9-11-26(12-10-25)23(30)21(28)24-18-6-7-18/h13-14,18-19H,4-12H2,1-3H3,(H,24,28) |
| InChIKey | YOKOIDBMFDIOSR-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 107.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.60 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|