C20H36N6O2 — CID 55802874
1-[3-(3,5-dimethylpiperidin-1-yl)propyl]-3-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]urea (PubChem CID 55802874) has the molecular formula C20H36N6O2 and a molecular weight of 392.55 g/mol. Its IUPAC name is 1-[3-(3,5-dimethylpiperidin-1-yl)propyl]-3-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]urea.
| Compound Name | 1-[3-(3,5-dimethylpiperidin-1-yl)propyl]-3-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]urea |
|---|---|
| PubChem CID | 55802874 |
| Molecular Formula | C20H36N6O2 |
| Molecular Weight | 392.55 g/mol |
| Exact Mass | 392.29 |
| IUPAC Name | 1-[3-(3,5-dimethylpiperidin-1-yl)propyl]-3-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]urea |
| SMILES | CC1CC(C)CN(CCCNC(=O)NCCCn2nc3n(c2=O)CCCC3)C1 |
| InChI | InChI=1S/C20H36N6O2/c1-16-13-17(2)15-24(14-16)10-5-8-21-19(27)22-9-6-12-26-20(28)25-11-4-3-7-18(25)23-26/h16-17H,3-15H2,1-2H3,(H2,21,22,27) |
| InChIKey | KALCBPZOOCTUNH-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 84.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.55 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|