About 3-ethenyl-3,5,5-trimethylcyclohexan-1-one
3-ethenyl-3,5,5-trimethylcyclohexan-1-one (PubChem CID 558033) has the molecular formula C11H18O
and a molecular weight of 166.26 g/mol. Its IUPAC name is 3-ethenyl-3,5,5-trimethylcyclohexan-1-one.
Molecular Properties
| Compound Name | 3-ethenyl-3,5,5-trimethylcyclohexan-1-one |
| PubChem CID | 558033 |
| Molecular Formula | C11H18O |
| Molecular Weight | 166.26 g/mol |
| Exact Mass | 166.14 |
| IUPAC Name | 3-ethenyl-3,5,5-trimethylcyclohexan-1-one |
| SMILES | C=CC1(C)CC(=O)CC(C)(C)C1 |
| InChI | InChI=1S/C11H18O/c1-5-11(4)7-9(12)6-10(2,3)8-11/h5H,1,6-8H2,2-4H3 |
| InChIKey | AZSYSENNSFSBSP-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.26 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-ethenyl-3,5,5-trimethylcyclohexan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethenyl-3,5,5-trimethylcyclohexan-1-one?
The IUPAC name of 3-ethenyl-3,5,5-trimethylcyclohexan-1-one (CID 558033) is 3-ethenyl-3,5,5-trimethylcyclohexan-1-one.
What is the SMILES notation for 3-ethenyl-3,5,5-trimethylcyclohexan-1-one?
The canonical SMILES for 3-ethenyl-3,5,5-trimethylcyclohexan-1-one is C=CC1(C)CC(=O)CC(C)(C)C1.
What is the InChIKey of 3-ethenyl-3,5,5-trimethylcyclohexan-1-one?
The InChIKey is AZSYSENNSFSBSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18O/c1-5-11(4)7-9(12)6-10(2,3)8-11/h5H,1,6-8H2,2-4H3.
What are the key properties of 3-ethenyl-3,5,5-trimethylcyclohexan-1-one?
3-ethenyl-3,5,5-trimethylcyclohexan-1-one has a molecular weight of 166.26 g/mol, XLogP of 2.96, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethenyl-3,5,5-trimethylcyclohexan-1-one is sourced from PubChem (CID 558033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).