C21H32N2O2 — CID 55806046
N-[2-[3-(4-propan-2-ylphenyl)propanoylamino]ethyl]cyclohexanecarboxamide (PubChem CID 55806046) has the molecular formula C21H32N2O2 and a molecular weight of 344.50 g/mol. Its IUPAC name is N-[2-[3-(4-propan-2-ylphenyl)propanoylamino]ethyl]cyclohexanecarboxamide.
| Compound Name | N-[2-[3-(4-propan-2-ylphenyl)propanoylamino]ethyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 55806046 |
| Molecular Formula | C21H32N2O2 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.25 |
| IUPAC Name | N-[2-[3-(4-propan-2-ylphenyl)propanoylamino]ethyl]cyclohexanecarboxamide |
| SMILES | CC(C)c1ccc(CCC(=O)NCCNC(=O)C2CCCCC2)cc1 |
| InChI | InChI=1S/C21H32N2O2/c1-16(2)18-11-8-17(9-12-18)10-13-20(24)22-14-15-23-21(25)19-6-4-3-5-7-19/h8-9,11-12,16,19H,3-7,10,13-15H2,1-2H3,(H,22,24)(H,23,25) |
| InChIKey | SWKIRMLGBULIAL-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|