C21H23NO4S — CID 55806198
2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl-[5-(2,3-dihydro-1,4-benzodioxin-6-yl)thiophen-2-yl]methanone (PubChem CID 55806198) has the molecular formula C21H23NO4S and a molecular weight of 385.49 g/mol. Its IUPAC name is 2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl-[5-(2,3-dihydro-1,4-benzodioxin-6-yl)thiophen-2-yl]methanone.
| Compound Name | 2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl-[5-(2,3-dihydro-1,4-benzodioxin-6-yl)thiophen-2-yl]methanone |
|---|---|
| PubChem CID | 55806198 |
| Molecular Formula | C21H23NO4S |
| Molecular Weight | 385.49 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | 2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl-[5-(2,3-dihydro-1,4-benzodioxin-6-yl)thiophen-2-yl]methanone |
| SMILES | O=C(c1ccc(-c2ccc3c(c2)OCCO3)s1)N1CCOC2CCCCC21 |
| InChI | InChI=1S/C21H23NO4S/c23-21(22-9-10-24-16-4-2-1-3-15(16)22)20-8-7-19(27-20)14-5-6-17-18(13-14)26-12-11-25-17/h5-8,13,15-16H,1-4,9-12H2 |
| InChIKey | XGLLDNQAOAODJV-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.49 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |