C25H29N3O4 — CID 55806370
2-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-[(2-phenylmethoxyphenyl)methyl]acetamide (PubChem CID 55806370) has the molecular formula C25H29N3O4 and a molecular weight of 435.52 g/mol. Its IUPAC name is 2-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-[(2-phenylmethoxyphenyl)methyl]acetamide.
| Compound Name | 2-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-[(2-phenylmethoxyphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 55806370 |
| Molecular Formula | C25H29N3O4 |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.22 |
| IUPAC Name | 2-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-[(2-phenylmethoxyphenyl)methyl]acetamide |
| SMILES | CC1CCC2(CC1)NC(=O)N(CC(=O)NCc1ccccc1OCc1ccccc1)C2=O |
| InChI | InChI=1S/C25H29N3O4/c1-18-11-13-25(14-12-18)23(30)28(24(31)27-25)16-22(29)26-15-20-9-5-6-10-21(20)32-17-19-7-3-2-4-8-19/h2-10,18H,11-17H2,1H3,(H,26,29)(H,27,31) |
| InChIKey | XDVAGAAOPBECFJ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|