About 3-[4-(3,5-dichloro-2-pyridinyl)piperazine-1-carbonyl]-3-methyl-4H-isochromen-1-one
3-[4-(3,5-dichloro-2-pyridinyl)piperazine-1-carbonyl]-3-methyl-4H-isochromen-1-one (PubChem CID 55808352) has the molecular formula C20H19Cl2N3O3
and a molecular weight of 420.30 g/mol. Its IUPAC name is 3-[4-(3,5-dichloro-2-pyridinyl)piperazine-1-carbonyl]-3-methyl-4H-isochromen-1-one.
Molecular Properties
| Compound Name | 3-[4-(3,5-dichloro-2-pyridinyl)piperazine-1-carbonyl]-3-methyl-4H-isochromen-1-one |
| PubChem CID | 55808352 |
| Molecular Formula | C20H19Cl2N3O3 |
| Molecular Weight | 420.30 g/mol |
| Exact Mass | 419.08 |
| IUPAC Name | 3-[4-(3,5-dichloro-2-pyridinyl)piperazine-1-carbonyl]-3-methyl-4H-isochromen-1-one |
| SMILES | CC1(C(=O)N2CCN(c3ncc(Cl)cc3Cl)CC2)Cc2ccccc2C(=O)O1 |
| InChI | InChI=1S/C20H19Cl2N3O3/c1-20(11-13-4-2-3-5-15(13)18(26)28-20)19(27)25-8-6-24(7-9-25)17-16(22)10-14(21)12-23-17/h2-5,10,12H,6-9,11H2,1H3 |
| InChIKey | FBVVRZRFOQDSQJ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 420.30 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[4-(3,5-dichloro-2-pyridinyl)piperazine-1-carbonyl]-3-methyl-4H-isochromen-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-(3,5-dichloro-2-pyridinyl)piperazine-1-carbonyl]-3-methyl-4H-isochromen-1-one?
The IUPAC name of 3-[4-(3,5-dichloro-2-pyridinyl)piperazine-1-carbonyl]-3-methyl-4H-isochromen-1-one (CID 55808352) is 3-[4-(3,5-dichloro-2-pyridinyl)piperazine-1-carbonyl]-3-methyl-4H-isochromen-1-one.
What is the SMILES notation for 3-[4-(3,5-dichloro-2-pyridinyl)piperazine-1-carbonyl]-3-methyl-4H-isochromen-1-one?
The canonical SMILES for 3-[4-(3,5-dichloro-2-pyridinyl)piperazine-1-carbonyl]-3-methyl-4H-isochromen-1-one is CC1(C(=O)N2CCN(c3ncc(Cl)cc3Cl)CC2)Cc2ccccc2C(=O)O1.
What is the InChIKey of 3-[4-(3,5-dichloro-2-pyridinyl)piperazine-1-carbonyl]-3-methyl-4H-isochromen-1-one?
The InChIKey is FBVVRZRFOQDSQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19Cl2N3O3/c1-20(11-13-4-2-3-5-15(13)18(26)28-20)19(27)25-8-6-24(7-9-25)17-16(22)10-14(21)12-23-17/h2-5,10,12H,6-9,11H2,1H3.
What are the key properties of 3-[4-(3,5-dichloro-2-pyridinyl)piperazine-1-carbonyl]-3-methyl-4H-isochromen-1-one?
3-[4-(3,5-dichloro-2-pyridinyl)piperazine-1-carbonyl]-3-methyl-4H-isochromen-1-one has a molecular weight of 420.30 g/mol, XLogP of 3.21, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-(3,5-dichloro-2-pyridinyl)piperazine-1-carbonyl]-3-methyl-4H-isochromen-1-one is sourced from PubChem (CID 55808352), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).