C19H22N4O2S — CID 55808540
N-pyridin-2-yl-1-[2-(pyridin-3-ylmethylsulfanyl)acetyl]piperidine-4-carboxamide (PubChem CID 55808540) has the molecular formula C19H22N4O2S and a molecular weight of 370.48 g/mol. Its IUPAC name is N-pyridin-2-yl-1-[2-(pyridin-3-ylmethylsulfanyl)acetyl]piperidine-4-carboxamide.
| Compound Name | N-pyridin-2-yl-1-[2-(pyridin-3-ylmethylsulfanyl)acetyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55808540 |
| Molecular Formula | C19H22N4O2S |
| Molecular Weight | 370.48 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | N-pyridin-2-yl-1-[2-(pyridin-3-ylmethylsulfanyl)acetyl]piperidine-4-carboxamide |
| SMILES | O=C(Nc1ccccn1)C1CCN(C(=O)CSCc2cccnc2)CC1 |
| InChI | InChI=1S/C19H22N4O2S/c24-18(14-26-13-15-4-3-8-20-12-15)23-10-6-16(7-11-23)19(25)22-17-5-1-2-9-21-17/h1-5,8-9,12,16H,6-7,10-11,13-14H2,(H,21,22,25) |
| InChIKey | FDZIUJFAFXCJDG-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.48 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |