About methyl 1-[[4-(2,5-dioxopyrrolidin-1-yl)benzoyl]amino]-4-methylcyclohexane-1-carboxylate
methyl 1-[[4-(2,5-dioxopyrrolidin-1-yl)benzoyl]amino]-4-methylcyclohexane-1-carboxylate (PubChem CID 55808955) has the molecular formula C20H24N2O5
and a molecular weight of 372.42 g/mol. Its IUPAC name is methyl 1-[[4-(2,5-dioxopyrrolidin-1-yl)benzoyl]amino]-4-methylcyclohexane-1-carboxylate.
Molecular Properties
| Compound Name | methyl 1-[[4-(2,5-dioxopyrrolidin-1-yl)benzoyl]amino]-4-methylcyclohexane-1-carboxylate |
| PubChem CID | 55808955 |
| Molecular Formula | C20H24N2O5 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | methyl 1-[[4-(2,5-dioxopyrrolidin-1-yl)benzoyl]amino]-4-methylcyclohexane-1-carboxylate |
| SMILES | COC(=O)C1(NC(=O)c2ccc(N3C(=O)CCC3=O)cc2)CCC(C)CC1 |
| InChI | InChI=1S/C20H24N2O5/c1-13-9-11-20(12-10-13,19(26)27-2)21-18(25)14-3-5-15(6-4-14)22-16(23)7-8-17(22)24/h3-6,13H,7-12H2,1-2H3,(H,21,25) |
| InChIKey | KWQFJUXKBBLRFJ-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze methyl 1-[[4-(2,5-dioxopyrrolidin-1-yl)benzoyl]amino]-4-methylcyclohexane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 1-[[4-(2,5-dioxopyrrolidin-1-yl)benzoyl]amino]-4-methylcyclohexane-1-carboxylate?
The IUPAC name of methyl 1-[[4-(2,5-dioxopyrrolidin-1-yl)benzoyl]amino]-4-methylcyclohexane-1-carboxylate (CID 55808955) is methyl 1-[[4-(2,5-dioxopyrrolidin-1-yl)benzoyl]amino]-4-methylcyclohexane-1-carboxylate.
What is the SMILES notation for methyl 1-[[4-(2,5-dioxopyrrolidin-1-yl)benzoyl]amino]-4-methylcyclohexane-1-carboxylate?
The canonical SMILES for methyl 1-[[4-(2,5-dioxopyrrolidin-1-yl)benzoyl]amino]-4-methylcyclohexane-1-carboxylate is COC(=O)C1(NC(=O)c2ccc(N3C(=O)CCC3=O)cc2)CCC(C)CC1.
What is the InChIKey of methyl 1-[[4-(2,5-dioxopyrrolidin-1-yl)benzoyl]amino]-4-methylcyclohexane-1-carboxylate?
The InChIKey is KWQFJUXKBBLRFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H24N2O5/c1-13-9-11-20(12-10-13,19(26)27-2)21-18(25)14-3-5-15(6-4-14)22-16(23)7-8-17(22)24/h3-6,13H,7-12H2,1-2H3,(H,21,25).
What are the key properties of methyl 1-[[4-(2,5-dioxopyrrolidin-1-yl)benzoyl]amino]-4-methylcyclohexane-1-carboxylate?
methyl 1-[[4-(2,5-dioxopyrrolidin-1-yl)benzoyl]amino]-4-methylcyclohexane-1-carboxylate has a molecular weight of 372.42 g/mol, XLogP of 2.19, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-[[4-(2,5-dioxopyrrolidin-1-yl)benzoyl]amino]-4-methylcyclohexane-1-carboxylate is sourced from PubChem (CID 55808955), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).