C23H41N7O3 — CID 55809181
4-N-[3-(diethylamino)propyl]-1-N-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]piperidine-1,4-dicarboxamide (PubChem CID 55809181) has the molecular formula C23H41N7O3 and a molecular weight of 463.63 g/mol. Its IUPAC name is 4-N-[3-(diethylamino)propyl]-1-N-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]piperidine-1,4-dicarboxamide.
| Compound Name | 4-N-[3-(diethylamino)propyl]-1-N-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]piperidine-1,4-dicarboxamide |
|---|---|
| PubChem CID | 55809181 |
| Molecular Formula | C23H41N7O3 |
| Molecular Weight | 463.63 g/mol |
| Exact Mass | 463.33 |
| IUPAC Name | 4-N-[3-(diethylamino)propyl]-1-N-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]piperidine-1,4-dicarboxamide |
| SMILES | CCN(CC)CCCNC(=O)C1CCN(C(=O)NCCCn2nc3n(c2=O)CCCC3)CC1 |
| InChI | InChI=1S/C23H41N7O3/c1-3-27(4-2)14-7-12-24-21(31)19-10-17-28(18-11-19)22(32)25-13-8-16-30-23(33)29-15-6-5-9-20(29)26-30/h19H,3-18H2,1-2H3,(H,24,31)(H,25,32) |
| InChIKey | MKNQIAXMQQSOKF-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 104.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.63 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|