About 5-chloro-6-(2,6-dichlorophenyl)sulfanylpyridine-3-carboxamide
5-chloro-6-(2,6-dichlorophenyl)sulfanylpyridine-3-carboxamide (PubChem CID 55809561) has the molecular formula C12H7Cl3N2OS
and a molecular weight of 333.63 g/mol. Its IUPAC name is 5-chloro-6-(2,6-dichlorophenyl)sulfanylpyridine-3-carboxamide.
Molecular Properties
| Compound Name | 5-chloro-6-(2,6-dichlorophenyl)sulfanylpyridine-3-carboxamide |
| PubChem CID | 55809561 |
| Molecular Formula | C12H7Cl3N2OS |
| Molecular Weight | 333.63 g/mol |
| Exact Mass | 331.93 |
| IUPAC Name | 5-chloro-6-(2,6-dichlorophenyl)sulfanylpyridine-3-carboxamide |
| SMILES | NC(=O)c1cnc(Sc2c(Cl)cccc2Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H7Cl3N2OS/c13-7-2-1-3-8(14)10(7)19-12-9(15)4-6(5-17-12)11(16)18/h1-5H,(H2,16,18) |
| InChIKey | REAHWFQIERVEHX-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.63 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-chloro-6-(2,6-dichlorophenyl)sulfanylpyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-6-(2,6-dichlorophenyl)sulfanylpyridine-3-carboxamide?
The IUPAC name of 5-chloro-6-(2,6-dichlorophenyl)sulfanylpyridine-3-carboxamide (CID 55809561) is 5-chloro-6-(2,6-dichlorophenyl)sulfanylpyridine-3-carboxamide.
What is the SMILES notation for 5-chloro-6-(2,6-dichlorophenyl)sulfanylpyridine-3-carboxamide?
The canonical SMILES for 5-chloro-6-(2,6-dichlorophenyl)sulfanylpyridine-3-carboxamide is NC(=O)c1cnc(Sc2c(Cl)cccc2Cl)c(Cl)c1.
What is the InChIKey of 5-chloro-6-(2,6-dichlorophenyl)sulfanylpyridine-3-carboxamide?
The InChIKey is REAHWFQIERVEHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H7Cl3N2OS/c13-7-2-1-3-8(14)10(7)19-12-9(15)4-6(5-17-12)11(16)18/h1-5H,(H2,16,18).
What are the key properties of 5-chloro-6-(2,6-dichlorophenyl)sulfanylpyridine-3-carboxamide?
5-chloro-6-(2,6-dichlorophenyl)sulfanylpyridine-3-carboxamide has a molecular weight of 333.63 g/mol, XLogP of 4.29, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-6-(2,6-dichlorophenyl)sulfanylpyridine-3-carboxamide is sourced from PubChem (CID 55809561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).