C23H29N5O2 — CID 55811199
1,3-dimethyl-N-(4-morpholin-4-ylbutyl)-6-phenylpyrazolo[5,4-b]pyridine-4-carboxamide (PubChem CID 55811199) has the molecular formula C23H29N5O2 and a molecular weight of 407.52 g/mol. Its IUPAC name is 1,3-dimethyl-N-(4-morpholin-4-ylbutyl)-6-phenylpyrazolo[5,4-b]pyridine-4-carboxamide.
| Compound Name | 1,3-dimethyl-N-(4-morpholin-4-ylbutyl)-6-phenylpyrazolo[5,4-b]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 55811199 |
| Molecular Formula | C23H29N5O2 |
| Molecular Weight | 407.52 g/mol |
| Exact Mass | 407.23 |
| IUPAC Name | 1,3-dimethyl-N-(4-morpholin-4-ylbutyl)-6-phenylpyrazolo[5,4-b]pyridine-4-carboxamide |
| SMILES | Cc1nn(C)c2nc(-c3ccccc3)cc(C(=O)NCCCCN3CCOCC3)c12 |
| InChI | InChI=1S/C23H29N5O2/c1-17-21-19(23(29)24-10-6-7-11-28-12-14-30-15-13-28)16-20(18-8-4-3-5-9-18)25-22(21)27(2)26-17/h3-5,8-9,16H,6-7,10-15H2,1-2H3,(H,24,29) |
| InChIKey | PVLKUKHCYRVPBH-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.52 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|