C19H18ClN3O3 — CID 55811527
N-[1-(3-chlorophenyl)ethyl]-3-ethyl-2,4-dioxo-1H-quinazoline-7-carboxamide (PubChem CID 55811527) has the molecular formula C19H18ClN3O3 and a molecular weight of 371.82 g/mol. Its IUPAC name is N-[1-(3-chlorophenyl)ethyl]-3-ethyl-2,4-dioxo-1H-quinazoline-7-carboxamide.
| Compound Name | N-[1-(3-chlorophenyl)ethyl]-3-ethyl-2,4-dioxo-1H-quinazoline-7-carboxamide |
|---|---|
| PubChem CID | 55811527 |
| Molecular Formula | C19H18ClN3O3 |
| Molecular Weight | 371.82 g/mol |
| Exact Mass | 371.10 |
| IUPAC Name | N-[1-(3-chlorophenyl)ethyl]-3-ethyl-2,4-dioxo-1H-quinazoline-7-carboxamide |
| SMILES | CCn1c(=O)[nH]c2cc(C(=O)NC(C)c3cccc(Cl)c3)ccc2c1=O |
| InChI | InChI=1S/C19H18ClN3O3/c1-3-23-18(25)15-8-7-13(10-16(15)22-19(23)26)17(24)21-11(2)12-5-4-6-14(20)9-12/h4-11H,3H2,1-2H3,(H,21,24)(H,22,26) |
| InChIKey | RHENTYWLYBVGBB-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 83.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.82 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |