C21H18FN5O — CID 55813226
N-[3-fluoro-4-(1,2,4-triazol-1-yl)phenyl]-6,7,8,9-tetrahydro-5H-carbazole-1-carboxamide (PubChem CID 55813226) has the molecular formula C21H18FN5O and a molecular weight of 375.41 g/mol. Its IUPAC name is N-[3-fluoro-4-(1,2,4-triazol-1-yl)phenyl]-6,7,8,9-tetrahydro-5H-carbazole-1-carboxamide.
| Compound Name | N-[3-fluoro-4-(1,2,4-triazol-1-yl)phenyl]-6,7,8,9-tetrahydro-5H-carbazole-1-carboxamide |
|---|---|
| PubChem CID | 55813226 |
| Molecular Formula | C21H18FN5O |
| Molecular Weight | 375.41 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | N-[3-fluoro-4-(1,2,4-triazol-1-yl)phenyl]-6,7,8,9-tetrahydro-5H-carbazole-1-carboxamide |
| SMILES | O=C(Nc1ccc(-n2cncn2)c(F)c1)c1cccc2c3c([nH]c12)CCCC3 |
| InChI | InChI=1S/C21H18FN5O/c22-17-10-13(8-9-19(17)27-12-23-11-24-27)25-21(28)16-6-3-5-15-14-4-1-2-7-18(14)26-20(15)16/h3,5-6,8-12,26H,1-2,4,7H2,(H,25,28) |
| InChIKey | DOUGYZLILDEUSY-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.41 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|