About 1-(4-fluorophenyl)-2,2-dimethyl-N-[(6-nitroindazol-1-yl)methyl]propan-1-amine
1-(4-fluorophenyl)-2,2-dimethyl-N-[(6-nitroindazol-1-yl)methyl]propan-1-amine (PubChem CID 55813404) has the molecular formula C19H21FN4O2
and a molecular weight of 356.40 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-2,2-dimethyl-N-[(6-nitroindazol-1-yl)methyl]propan-1-amine.
Molecular Properties
| Compound Name | 1-(4-fluorophenyl)-2,2-dimethyl-N-[(6-nitroindazol-1-yl)methyl]propan-1-amine |
| PubChem CID | 55813404 |
| Molecular Formula | C19H21FN4O2 |
| Molecular Weight | 356.40 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | 1-(4-fluorophenyl)-2,2-dimethyl-N-[(6-nitroindazol-1-yl)methyl]propan-1-amine |
| SMILES | CC(C)(C)C(NCn1ncc2ccc([N+](=O)[O-])cc21)c1ccc(F)cc1 |
| InChI | InChI=1S/C19H21FN4O2/c1-19(2,3)18(13-4-7-15(20)8-5-13)21-12-23-17-10-16(24(25)26)9-6-14(17)11-22-23/h4-11,18,21H,12H2,1-3H3 |
| InChIKey | SVBFZIFRZONLTM-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 72.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.40 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-fluorophenyl)-2,2-dimethyl-N-[(6-nitroindazol-1-yl)methyl]propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-fluorophenyl)-2,2-dimethyl-N-[(6-nitroindazol-1-yl)methyl]propan-1-amine?
The IUPAC name of 1-(4-fluorophenyl)-2,2-dimethyl-N-[(6-nitroindazol-1-yl)methyl]propan-1-amine (CID 55813404) is 1-(4-fluorophenyl)-2,2-dimethyl-N-[(6-nitroindazol-1-yl)methyl]propan-1-amine.
What is the SMILES notation for 1-(4-fluorophenyl)-2,2-dimethyl-N-[(6-nitroindazol-1-yl)methyl]propan-1-amine?
The canonical SMILES for 1-(4-fluorophenyl)-2,2-dimethyl-N-[(6-nitroindazol-1-yl)methyl]propan-1-amine is CC(C)(C)C(NCn1ncc2ccc([N+](=O)[O-])cc21)c1ccc(F)cc1.
What is the InChIKey of 1-(4-fluorophenyl)-2,2-dimethyl-N-[(6-nitroindazol-1-yl)methyl]propan-1-amine?
The InChIKey is SVBFZIFRZONLTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21FN4O2/c1-19(2,3)18(13-4-7-15(20)8-5-13)21-12-23-17-10-16(24(25)26)9-6-14(17)11-22-23/h4-11,18,21H,12H2,1-3H3.
What are the key properties of 1-(4-fluorophenyl)-2,2-dimethyl-N-[(6-nitroindazol-1-yl)methyl]propan-1-amine?
1-(4-fluorophenyl)-2,2-dimethyl-N-[(6-nitroindazol-1-yl)methyl]propan-1-amine has a molecular weight of 356.40 g/mol, XLogP of 4.42, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-fluorophenyl)-2,2-dimethyl-N-[(6-nitroindazol-1-yl)methyl]propan-1-amine is sourced from PubChem (CID 55813404), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).