About 6,8-diazatricyclo[6.4.0.02,6]dodecane
6,8-diazatricyclo[6.4.0.02,6]dodecane (PubChem CID 558140) has the molecular formula C10H18N2
and a molecular weight of 166.27 g/mol. Its IUPAC name is 6,8-diazatricyclo[6.4.0.02,6]dodecane.
Molecular Properties
| Compound Name | 6,8-diazatricyclo[6.4.0.02,6]dodecane |
| PubChem CID | 558140 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | 6,8-diazatricyclo[6.4.0.02,6]dodecane |
| SMILES | C1CCN2CN3CCCC3C2C1 |
| InChI | InChI=1S/C10H18N2/c1-2-6-11-8-12-7-3-5-10(12)9(11)4-1/h9-10H,1-8H2 |
| InChIKey | GRMJLCGROWJCIZ-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6,8-diazatricyclo[6.4.0.02,6]dodecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,8-diazatricyclo[6.4.0.02,6]dodecane?
The IUPAC name of 6,8-diazatricyclo[6.4.0.02,6]dodecane (CID 558140) is 6,8-diazatricyclo[6.4.0.02,6]dodecane.
What is the SMILES notation for 6,8-diazatricyclo[6.4.0.02,6]dodecane?
The canonical SMILES for 6,8-diazatricyclo[6.4.0.02,6]dodecane is C1CCN2CN3CCCC3C2C1.
What is the InChIKey of 6,8-diazatricyclo[6.4.0.02,6]dodecane?
The InChIKey is GRMJLCGROWJCIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N2/c1-2-6-11-8-12-7-3-5-10(12)9(11)4-1/h9-10H,1-8H2.
What are the key properties of 6,8-diazatricyclo[6.4.0.02,6]dodecane?
6,8-diazatricyclo[6.4.0.02,6]dodecane has a molecular weight of 166.27 g/mol, XLogP of 1.28, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6,8-diazatricyclo[6.4.0.02,6]dodecane is sourced from PubChem (CID 558140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).