C17H25N5O5S — CID 55815802
N,1-dimethyl-5-[4-(2-oxo-2-pyrrolidin-1-ylacetyl)piperazine-1-carbonyl]pyrrole-3-sulfonamide (PubChem CID 55815802) has the molecular formula C17H25N5O5S and a molecular weight of 411.48 g/mol. Its IUPAC name is N,1-dimethyl-5-[4-(2-oxo-2-pyrrolidin-1-ylacetyl)piperazine-1-carbonyl]pyrrole-3-sulfonamide.
| Compound Name | N,1-dimethyl-5-[4-(2-oxo-2-pyrrolidin-1-ylacetyl)piperazine-1-carbonyl]pyrrole-3-sulfonamide |
|---|---|
| PubChem CID | 55815802 |
| Molecular Formula | C17H25N5O5S |
| Molecular Weight | 411.48 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | N,1-dimethyl-5-[4-(2-oxo-2-pyrrolidin-1-ylacetyl)piperazine-1-carbonyl]pyrrole-3-sulfonamide |
| SMILES | CNS(=O)(=O)c1cc(C(=O)N2CCN(C(=O)C(=O)N3CCCC3)CC2)n(C)c1 |
| InChI | InChI=1S/C17H25N5O5S/c1-18-28(26,27)13-11-14(19(2)12-13)15(23)21-7-9-22(10-8-21)17(25)16(24)20-5-3-4-6-20/h11-12,18H,3-10H2,1-2H3 |
| InChIKey | KAMVTWOLZHHDSK-UHFFFAOYSA-N |
| XLogP | -1.16 |
| TPSA | 112.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.48 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|