C24H24N2O3 — CID 55816792
N-[2-(2,3-dihydroindol-1-ylmethyl)phenyl]-2,4-dimethoxybenzamide (PubChem CID 55816792) has the molecular formula C24H24N2O3 and a molecular weight of 388.47 g/mol. Its IUPAC name is N-[2-(2,3-dihydroindol-1-ylmethyl)phenyl]-2,4-dimethoxybenzamide.
| Compound Name | N-[2-(2,3-dihydroindol-1-ylmethyl)phenyl]-2,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 55816792 |
| Molecular Formula | C24H24N2O3 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | N-[2-(2,3-dihydroindol-1-ylmethyl)phenyl]-2,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)Nc2ccccc2CN2CCc3ccccc32)c(OC)c1 |
| InChI | InChI=1S/C24H24N2O3/c1-28-19-11-12-20(23(15-19)29-2)24(27)25-21-9-5-3-8-18(21)16-26-14-13-17-7-4-6-10-22(17)26/h3-12,15H,13-14,16H2,1-2H3,(H,25,27) |
| InChIKey | AJLDEHZXELXQFO-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |