About hexadecan-4-yl 3-methylbut-2-enoate
hexadecan-4-yl 3-methylbut-2-enoate (PubChem CID 558170) has the molecular formula C21H40O2
and a molecular weight of 324.55 g/mol. Its IUPAC name is hexadecan-4-yl 3-methylbut-2-enoate.
Molecular Properties
| Compound Name | hexadecan-4-yl 3-methylbut-2-enoate |
| PubChem CID | 558170 |
| Molecular Formula | C21H40O2 |
| Molecular Weight | 324.55 g/mol |
| Exact Mass | 324.30 |
| IUPAC Name | hexadecan-4-yl 3-methylbut-2-enoate |
| SMILES | CCCCCCCCCCCCC(CCC)OC(=O)C=C(C)C |
| InChI | InChI=1S/C21H40O2/c1-5-7-8-9-10-11-12-13-14-15-17-20(16-6-2)23-21(22)18-19(3)4/h18,20H,5-17H2,1-4H3 |
| InChIKey | KMAJMLGOJBTPTH-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 324.55 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze hexadecan-4-yl 3-methylbut-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexadecan-4-yl 3-methylbut-2-enoate?
The IUPAC name of hexadecan-4-yl 3-methylbut-2-enoate (CID 558170) is hexadecan-4-yl 3-methylbut-2-enoate.
What is the SMILES notation for hexadecan-4-yl 3-methylbut-2-enoate?
The canonical SMILES for hexadecan-4-yl 3-methylbut-2-enoate is CCCCCCCCCCCCC(CCC)OC(=O)C=C(C)C.
What is the InChIKey of hexadecan-4-yl 3-methylbut-2-enoate?
The InChIKey is KMAJMLGOJBTPTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H40O2/c1-5-7-8-9-10-11-12-13-14-15-17-20(16-6-2)23-21(22)18-19(3)4/h18,20H,5-17H2,1-4H3.
What are the key properties of hexadecan-4-yl 3-methylbut-2-enoate?
hexadecan-4-yl 3-methylbut-2-enoate has a molecular weight of 324.55 g/mol, XLogP of 6.98, 15 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for hexadecan-4-yl 3-methylbut-2-enoate is sourced from PubChem (CID 558170), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).