C18H15N5O5S — CID 55817948
[1-(3-nitroanilino)-1-oxopropan-2-yl] 4-methyl-2-pyrimidin-2-yl-1,3-thiazole-5-carboxylate (PubChem CID 55817948) has the molecular formula C18H15N5O5S and a molecular weight of 413.42 g/mol. Its IUPAC name is [1-(3-nitroanilino)-1-oxopropan-2-yl] 4-methyl-2-pyrimidin-2-yl-1,3-thiazole-5-carboxylate.
| Compound Name | [1-(3-nitroanilino)-1-oxopropan-2-yl] 4-methyl-2-pyrimidin-2-yl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 55817948 |
| Molecular Formula | C18H15N5O5S |
| Molecular Weight | 413.42 g/mol |
| Exact Mass | 413.08 |
| IUPAC Name | [1-(3-nitroanilino)-1-oxopropan-2-yl] 4-methyl-2-pyrimidin-2-yl-1,3-thiazole-5-carboxylate |
| SMILES | Cc1nc(-c2ncccn2)sc1C(=O)OC(C)C(=O)Nc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H15N5O5S/c1-10-14(29-17(21-10)15-19-7-4-8-20-15)18(25)28-11(2)16(24)22-12-5-3-6-13(9-12)23(26)27/h3-9,11H,1-2H3,(H,22,24) |
| InChIKey | OGWYKWQEKXKLRN-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 137.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.42 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|