About (5-nitrothiophen-3-yl)methyl 4-[(2,5-dioxopyrrolidin-1-yl)methyl]benzoate
(5-nitrothiophen-3-yl)methyl 4-[(2,5-dioxopyrrolidin-1-yl)methyl]benzoate (PubChem CID 55818005) has the molecular formula C17H14N2O6S
and a molecular weight of 374.37 g/mol. Its IUPAC name is (5-nitrothiophen-3-yl)methyl 4-[(2,5-dioxopyrrolidin-1-yl)methyl]benzoate.
Molecular Properties
| Compound Name | (5-nitrothiophen-3-yl)methyl 4-[(2,5-dioxopyrrolidin-1-yl)methyl]benzoate |
| PubChem CID | 55818005 |
| Molecular Formula | C17H14N2O6S |
| Molecular Weight | 374.37 g/mol |
| Exact Mass | 374.06 |
| IUPAC Name | (5-nitrothiophen-3-yl)methyl 4-[(2,5-dioxopyrrolidin-1-yl)methyl]benzoate |
| SMILES | O=C(OCc1csc([N+](=O)[O-])c1)c1ccc(CN2C(=O)CCC2=O)cc1 |
| InChI | InChI=1S/C17H14N2O6S/c20-14-5-6-15(21)18(14)8-11-1-3-13(4-2-11)17(22)25-9-12-7-16(19(23)24)26-10-12/h1-4,7,10H,5-6,8-9H2 |
| InChIKey | MDHJIAHYOUNUTF-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 106.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.37 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze (5-nitrothiophen-3-yl)methyl 4-[(2,5-dioxopyrrolidin-1-yl)methyl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-nitrothiophen-3-yl)methyl 4-[(2,5-dioxopyrrolidin-1-yl)methyl]benzoate?
The IUPAC name of (5-nitrothiophen-3-yl)methyl 4-[(2,5-dioxopyrrolidin-1-yl)methyl]benzoate (CID 55818005) is (5-nitrothiophen-3-yl)methyl 4-[(2,5-dioxopyrrolidin-1-yl)methyl]benzoate.
What is the SMILES notation for (5-nitrothiophen-3-yl)methyl 4-[(2,5-dioxopyrrolidin-1-yl)methyl]benzoate?
The canonical SMILES for (5-nitrothiophen-3-yl)methyl 4-[(2,5-dioxopyrrolidin-1-yl)methyl]benzoate is O=C(OCc1csc([N+](=O)[O-])c1)c1ccc(CN2C(=O)CCC2=O)cc1.
What is the InChIKey of (5-nitrothiophen-3-yl)methyl 4-[(2,5-dioxopyrrolidin-1-yl)methyl]benzoate?
The InChIKey is MDHJIAHYOUNUTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14N2O6S/c20-14-5-6-15(21)18(14)8-11-1-3-13(4-2-11)17(22)25-9-12-7-16(19(23)24)26-10-12/h1-4,7,10H,5-6,8-9H2.
What are the key properties of (5-nitrothiophen-3-yl)methyl 4-[(2,5-dioxopyrrolidin-1-yl)methyl]benzoate?
(5-nitrothiophen-3-yl)methyl 4-[(2,5-dioxopyrrolidin-1-yl)methyl]benzoate has a molecular weight of 374.37 g/mol, XLogP of 2.66, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (5-nitrothiophen-3-yl)methyl 4-[(2,5-dioxopyrrolidin-1-yl)methyl]benzoate is sourced from PubChem (CID 55818005), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).