C17H11Cl3N4O3S — CID 55818042
[2-oxo-2-(2,4,5-trichloroanilino)ethyl] 4-methyl-2-pyrimidin-2-yl-1,3-thiazole-5-carboxylate (PubChem CID 55818042) has the molecular formula C17H11Cl3N4O3S and a molecular weight of 457.73 g/mol. Its IUPAC name is [2-oxo-2-(2,4,5-trichloroanilino)ethyl] 4-methyl-2-pyrimidin-2-yl-1,3-thiazole-5-carboxylate.
| Compound Name | [2-oxo-2-(2,4,5-trichloroanilino)ethyl] 4-methyl-2-pyrimidin-2-yl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 55818042 |
| Molecular Formula | C17H11Cl3N4O3S |
| Molecular Weight | 457.73 g/mol |
| Exact Mass | 455.96 |
| IUPAC Name | [2-oxo-2-(2,4,5-trichloroanilino)ethyl] 4-methyl-2-pyrimidin-2-yl-1,3-thiazole-5-carboxylate |
| SMILES | Cc1nc(-c2ncccn2)sc1C(=O)OCC(=O)Nc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C17H11Cl3N4O3S/c1-8-14(28-16(23-8)15-21-3-2-4-22-15)17(26)27-7-13(25)24-12-6-10(19)9(18)5-11(12)20/h2-6H,7H2,1H3,(H,24,25) |
| InChIKey | MIEVHSOEFVQTGR-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 94.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.73 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|