About dipropan-2-yl hydrogen phosphite
dipropan-2-yl hydrogen phosphite (PubChem CID 558181) has the molecular formula C6H15O3P
and a molecular weight of 166.16 g/mol. Its IUPAC name is dipropan-2-yl hydrogen phosphite.
Molecular Properties
| Compound Name | dipropan-2-yl hydrogen phosphite |
| PubChem CID | 558181 |
| Molecular Formula | C6H15O3P |
| Molecular Weight | 166.16 g/mol |
| Exact Mass | 166.08 |
| IUPAC Name | dipropan-2-yl hydrogen phosphite |
| SMILES | CC(C)OP(O)OC(C)C |
| InChI | InChI=1S/C6H15O3P/c1-5(2)8-10(7)9-6(3)4/h5-7H,1-4H3 |
| InChIKey | NFORZJQPTUSMRL-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.16 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dipropan-2-yl hydrogen phosphite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dipropan-2-yl hydrogen phosphite?
The IUPAC name of dipropan-2-yl hydrogen phosphite (CID 558181) is dipropan-2-yl hydrogen phosphite.
What is the SMILES notation for dipropan-2-yl hydrogen phosphite?
The canonical SMILES for dipropan-2-yl hydrogen phosphite is CC(C)OP(O)OC(C)C.
What is the InChIKey of dipropan-2-yl hydrogen phosphite?
The InChIKey is NFORZJQPTUSMRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15O3P/c1-5(2)8-10(7)9-6(3)4/h5-7H,1-4H3.
What are the key properties of dipropan-2-yl hydrogen phosphite?
dipropan-2-yl hydrogen phosphite has a molecular weight of 166.16 g/mol, XLogP of 2.06, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dipropan-2-yl hydrogen phosphite is sourced from PubChem (CID 558181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).