C21H26N4O5 — CID 55818884
N-[2-[[4-[2-(ethylamino)-2-oxoethoxy]phenyl]carbamoylamino]ethyl]-4-methoxybenzamide (PubChem CID 55818884) has the molecular formula C21H26N4O5 and a molecular weight of 414.46 g/mol. Its IUPAC name is N-[2-[[4-[2-(ethylamino)-2-oxoethoxy]phenyl]carbamoylamino]ethyl]-4-methoxybenzamide.
| Compound Name | N-[2-[[4-[2-(ethylamino)-2-oxoethoxy]phenyl]carbamoylamino]ethyl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 55818884 |
| Molecular Formula | C21H26N4O5 |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | N-[2-[[4-[2-(ethylamino)-2-oxoethoxy]phenyl]carbamoylamino]ethyl]-4-methoxybenzamide |
| SMILES | CCNC(=O)COc1ccc(NC(=O)NCCNC(=O)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C21H26N4O5/c1-3-22-19(26)14-30-18-10-6-16(7-11-18)25-21(28)24-13-12-23-20(27)15-4-8-17(29-2)9-5-15/h4-11H,3,12-14H2,1-2H3,(H,22,26)(H,23,27)(H2,24,25,28) |
| InChIKey | PZRQPUDFQSAWRG-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 117.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|