C23H23N3O2 — CID 55819926
N-[3-[(2,4-dimethylphenyl)methylcarbamoylamino]phenyl]benzamide (PubChem CID 55819926) has the molecular formula C23H23N3O2 and a molecular weight of 373.46 g/mol. Its IUPAC name is N-[3-[(2,4-dimethylphenyl)methylcarbamoylamino]phenyl]benzamide.
| Compound Name | N-[3-[(2,4-dimethylphenyl)methylcarbamoylamino]phenyl]benzamide |
|---|---|
| PubChem CID | 55819926 |
| Molecular Formula | C23H23N3O2 |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | N-[3-[(2,4-dimethylphenyl)methylcarbamoylamino]phenyl]benzamide |
| SMILES | Cc1ccc(CNC(=O)Nc2cccc(NC(=O)c3ccccc3)c2)c(C)c1 |
| InChI | InChI=1S/C23H23N3O2/c1-16-11-12-19(17(2)13-16)15-24-23(28)26-21-10-6-9-20(14-21)25-22(27)18-7-4-3-5-8-18/h3-14H,15H2,1-2H3,(H,25,27)(H2,24,26,28) |
| InChIKey | QUEMRXXBOMRPNS-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |