C19H24N5O3+ — CID 5582
5-methyl-6-[(3,4,5-trimethoxyanilino)methyl]quinazolin-3-ium-2,4-diamine (PubChem CID 5582) has the molecular formula C19H24N5O3+ and a molecular weight of 370.43 g/mol. Its IUPAC name is 5-methyl-6-[(3,4,5-trimethoxyanilino)methyl]quinazolin-3-ium-2,4-diamine.
| Compound Name | 5-methyl-6-[(3,4,5-trimethoxyanilino)methyl]quinazolin-3-ium-2,4-diamine |
|---|---|
| PubChem CID | 5582 |
| Molecular Formula | C19H24N5O3+ |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | 5-methyl-6-[(3,4,5-trimethoxyanilino)methyl]quinazolin-3-ium-2,4-diamine |
| SMILES | COc1cc(NCc2ccc3nc(N)[nH+]c(N)c3c2C)cc(OC)c1OC |
| InChI | InChI=1S/C19H23N5O3/c1-10-11(5-6-13-16(10)18(20)24-19(21)23-13)9-22-12-7-14(25-2)17(27-4)15(8-12)26-3/h5-8,22H,9H2,1-4H3,(H4,20,21,23,24)/p+1 |
| InChIKey | NOYPYLRCIDNJJB-UHFFFAOYSA-O |
| XLogP | 2.16 |
| TPSA | 118.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|