C25H30N4O3 — CID 55820466
1-[3-(oxan-2-ylmethoxymethyl)phenyl]-3-[[4-(pyrazol-1-ylmethyl)phenyl]methyl]urea (PubChem CID 55820466) has the molecular formula C25H30N4O3 and a molecular weight of 434.54 g/mol. Its IUPAC name is 1-[3-(oxan-2-ylmethoxymethyl)phenyl]-3-[[4-(pyrazol-1-ylmethyl)phenyl]methyl]urea.
| Compound Name | 1-[3-(oxan-2-ylmethoxymethyl)phenyl]-3-[[4-(pyrazol-1-ylmethyl)phenyl]methyl]urea |
|---|---|
| PubChem CID | 55820466 |
| Molecular Formula | C25H30N4O3 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.23 |
| IUPAC Name | 1-[3-(oxan-2-ylmethoxymethyl)phenyl]-3-[[4-(pyrazol-1-ylmethyl)phenyl]methyl]urea |
| SMILES | O=C(NCc1ccc(Cn2cccn2)cc1)Nc1cccc(COCC2CCCCO2)c1 |
| InChI | InChI=1S/C25H30N4O3/c30-25(26-16-20-8-10-21(11-9-20)17-29-13-4-12-27-29)28-23-6-3-5-22(15-23)18-31-19-24-7-1-2-14-32-24/h3-6,8-13,15,24H,1-2,7,14,16-19H2,(H2,26,28,30) |
| InChIKey | ABWMZNXWXUESBN-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 77.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |