C20H21FN4O3 — CID 55820751
3-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-N-(3-fluoro-4-pyrazol-1-ylphenyl)propanamide (PubChem CID 55820751) has the molecular formula C20H21FN4O3 and a molecular weight of 384.41 g/mol. Its IUPAC name is 3-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-N-(3-fluoro-4-pyrazol-1-ylphenyl)propanamide.
| Compound Name | 3-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-N-(3-fluoro-4-pyrazol-1-ylphenyl)propanamide |
|---|---|
| PubChem CID | 55820751 |
| Molecular Formula | C20H21FN4O3 |
| Molecular Weight | 384.41 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | 3-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-N-(3-fluoro-4-pyrazol-1-ylphenyl)propanamide |
| SMILES | O=C(CCN1C(=O)C2CCCCC2C1=O)Nc1ccc(-n2cccn2)c(F)c1 |
| InChI | InChI=1S/C20H21FN4O3/c21-16-12-13(6-7-17(16)25-10-3-9-22-25)23-18(26)8-11-24-19(27)14-4-1-2-5-15(14)20(24)28/h3,6-7,9-10,12,14-15H,1-2,4-5,8,11H2,(H,23,26) |
| InChIKey | MDVLPEJXLKYZRM-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.41 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|