C18H23FN4O4 — CID 55822078
N'-[2-(4-fluorophenoxy)propanoyl]-4-(3-propyl-1,2,4-oxadiazol-5-yl)butanehydrazide (PubChem CID 55822078) has the molecular formula C18H23FN4O4 and a molecular weight of 378.40 g/mol. Its IUPAC name is N'-[2-(4-fluorophenoxy)propanoyl]-4-(3-propyl-1,2,4-oxadiazol-5-yl)butanehydrazide.
| Compound Name | N'-[2-(4-fluorophenoxy)propanoyl]-4-(3-propyl-1,2,4-oxadiazol-5-yl)butanehydrazide |
|---|---|
| PubChem CID | 55822078 |
| Molecular Formula | C18H23FN4O4 |
| Molecular Weight | 378.40 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | N'-[2-(4-fluorophenoxy)propanoyl]-4-(3-propyl-1,2,4-oxadiazol-5-yl)butanehydrazide |
| SMILES | CCCc1noc(CCCC(=O)NNC(=O)C(C)Oc2ccc(F)cc2)n1 |
| InChI | InChI=1S/C18H23FN4O4/c1-3-5-15-20-17(27-23-15)7-4-6-16(24)21-22-18(25)12(2)26-14-10-8-13(19)9-11-14/h8-12H,3-7H2,1-2H3,(H,21,24)(H,22,25) |
| InChIKey | FQFLWVCRLCSBGY-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 106.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.40 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|