C20H21ClN4OS — CID 55823340
2-chloro-N-[4-[(3-methylpiperidin-1-yl)methyl]-1,3-thiazol-2-yl]quinoline-6-carboxamide (PubChem CID 55823340) has the molecular formula C20H21ClN4OS and a molecular weight of 400.94 g/mol. Its IUPAC name is 2-chloro-N-[4-[(3-methylpiperidin-1-yl)methyl]-1,3-thiazol-2-yl]quinoline-6-carboxamide.
| Compound Name | 2-chloro-N-[4-[(3-methylpiperidin-1-yl)methyl]-1,3-thiazol-2-yl]quinoline-6-carboxamide |
|---|---|
| PubChem CID | 55823340 |
| Molecular Formula | C20H21ClN4OS |
| Molecular Weight | 400.94 g/mol |
| Exact Mass | 400.11 |
| IUPAC Name | 2-chloro-N-[4-[(3-methylpiperidin-1-yl)methyl]-1,3-thiazol-2-yl]quinoline-6-carboxamide |
| SMILES | CC1CCCN(Cc2csc(NC(=O)c3ccc4nc(Cl)ccc4c3)n2)C1 |
| InChI | InChI=1S/C20H21ClN4OS/c1-13-3-2-8-25(10-13)11-16-12-27-20(22-16)24-19(26)15-4-6-17-14(9-15)5-7-18(21)23-17/h4-7,9,12-13H,2-3,8,10-11H2,1H3,(H,22,24,26) |
| InChIKey | RFTAMRDZLQKPBC-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.94 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|