C14H15BrN2O3S2 — CID 55823968
N-(4-bromophenyl)sulfonyl-4-methyl-2-propyl-1,3-thiazole-5-carboxamide (PubChem CID 55823968) has the molecular formula C14H15BrN2O3S2 and a molecular weight of 403.32 g/mol. Its IUPAC name is N-(4-bromophenyl)sulfonyl-4-methyl-2-propyl-1,3-thiazole-5-carboxamide.
| Compound Name | N-(4-bromophenyl)sulfonyl-4-methyl-2-propyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 55823968 |
| Molecular Formula | C14H15BrN2O3S2 |
| Molecular Weight | 403.32 g/mol |
| Exact Mass | 401.97 |
| IUPAC Name | N-(4-bromophenyl)sulfonyl-4-methyl-2-propyl-1,3-thiazole-5-carboxamide |
| SMILES | CCCc1nc(C)c(C(=O)NS(=O)(=O)c2ccc(Br)cc2)s1 |
| InChI | InChI=1S/C14H15BrN2O3S2/c1-3-4-12-16-9(2)13(21-12)14(18)17-22(19,20)11-7-5-10(15)6-8-11/h5-8H,3-4H2,1-2H3,(H,17,18) |
| InChIKey | SYOLBMVZXHCYDU-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.32 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |