C23H29N3O3 — CID 55824936
2-(3-methyl-4-propan-2-ylphenoxy)-N-[4-(prop-2-enylcarbamoylamino)phenyl]propanamide (PubChem CID 55824936) has the molecular formula C23H29N3O3 and a molecular weight of 395.50 g/mol. Its IUPAC name is 2-(3-methyl-4-propan-2-ylphenoxy)-N-[4-(prop-2-enylcarbamoylamino)phenyl]propanamide.
| Compound Name | 2-(3-methyl-4-propan-2-ylphenoxy)-N-[4-(prop-2-enylcarbamoylamino)phenyl]propanamide |
|---|---|
| PubChem CID | 55824936 |
| Molecular Formula | C23H29N3O3 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.22 |
| IUPAC Name | 2-(3-methyl-4-propan-2-ylphenoxy)-N-[4-(prop-2-enylcarbamoylamino)phenyl]propanamide |
| SMILES | C=CCNC(=O)Nc1ccc(NC(=O)C(C)Oc2ccc(C(C)C)c(C)c2)cc1 |
| InChI | InChI=1S/C23H29N3O3/c1-6-13-24-23(28)26-19-9-7-18(8-10-19)25-22(27)17(5)29-20-11-12-21(15(2)3)16(4)14-20/h6-12,14-15,17H,1,13H2,2-5H3,(H,25,27)(H2,24,26,28) |
| InChIKey | AIFICXMBNIFRKQ-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|