C24H28N4O4 — CID 55824983
1-[2-[4-(6-methyl-6,7,8,9-tetrahydro-5H-carbazole-1-carbonyl)piperazin-1-yl]-2-oxoethyl]pyrrolidine-2,5-dione (PubChem CID 55824983) has the molecular formula C24H28N4O4 and a molecular weight of 436.51 g/mol. Its IUPAC name is 1-[2-[4-(6-methyl-6,7,8,9-tetrahydro-5H-carbazole-1-carbonyl)piperazin-1-yl]-2-oxoethyl]pyrrolidine-2,5-dione.
| Compound Name | 1-[2-[4-(6-methyl-6,7,8,9-tetrahydro-5H-carbazole-1-carbonyl)piperazin-1-yl]-2-oxoethyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 55824983 |
| Molecular Formula | C24H28N4O4 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.21 |
| IUPAC Name | 1-[2-[4-(6-methyl-6,7,8,9-tetrahydro-5H-carbazole-1-carbonyl)piperazin-1-yl]-2-oxoethyl]pyrrolidine-2,5-dione |
| SMILES | CC1CCc2[nH]c3c(C(=O)N4CCN(C(=O)CN5C(=O)CCC5=O)CC4)cccc3c2C1 |
| InChI | InChI=1S/C24H28N4O4/c1-15-5-6-19-18(13-15)16-3-2-4-17(23(16)25-19)24(32)27-11-9-26(10-12-27)22(31)14-28-20(29)7-8-21(28)30/h2-4,15,25H,5-14H2,1H3 |
| InChIKey | NICHMMQCJQQXAA-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 93.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|