C20H31N3O4 — CID 55824988
1-[2-[4-(4-cyclohexylbutanoyl)piperazin-1-yl]-2-oxoethyl]pyrrolidine-2,5-dione (PubChem CID 55824988) has the molecular formula C20H31N3O4 and a molecular weight of 377.49 g/mol. Its IUPAC name is 1-[2-[4-(4-cyclohexylbutanoyl)piperazin-1-yl]-2-oxoethyl]pyrrolidine-2,5-dione.
| Compound Name | 1-[2-[4-(4-cyclohexylbutanoyl)piperazin-1-yl]-2-oxoethyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 55824988 |
| Molecular Formula | C20H31N3O4 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.23 |
| IUPAC Name | 1-[2-[4-(4-cyclohexylbutanoyl)piperazin-1-yl]-2-oxoethyl]pyrrolidine-2,5-dione |
| SMILES | O=C(CCCC1CCCCC1)N1CCN(C(=O)CN2C(=O)CCC2=O)CC1 |
| InChI | InChI=1S/C20H31N3O4/c24-17(8-4-7-16-5-2-1-3-6-16)21-11-13-22(14-12-21)20(27)15-23-18(25)9-10-19(23)26/h16H,1-15H2 |
| InChIKey | ODQKHSZFMZLWSL-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|