About bis(5-methyl-2-propan-2-ylcyclohexyl) 2,3-dihydroxybutanedioate
bis(5-methyl-2-propan-2-ylcyclohexyl) 2,3-dihydroxybutanedioate (PubChem CID 558259) has the molecular formula C24H42O6
and a molecular weight of 426.59 g/mol. Its IUPAC name is bis(5-methyl-2-propan-2-ylcyclohexyl) 2,3-dihydroxybutanedioate.
Molecular Properties
| Compound Name | bis(5-methyl-2-propan-2-ylcyclohexyl) 2,3-dihydroxybutanedioate |
| PubChem CID | 558259 |
| Molecular Formula | C24H42O6 |
| Molecular Weight | 426.59 g/mol |
| Exact Mass | 426.30 |
| IUPAC Name | bis(5-methyl-2-propan-2-ylcyclohexyl) 2,3-dihydroxybutanedioate |
| SMILES | CC1CCC(C(C)C)C(OC(=O)C(O)C(O)C(=O)OC2CC(C)CCC2C(C)C)C1 |
| InChI | InChI=1S/C24H42O6/c1-13(2)17-9-7-15(5)11-19(17)29-23(27)21(25)22(26)24(28)30-20-12-16(6)8-10-18(20)14(3)4/h13-22,25-26H,7-12H2,1-6H3 |
| InChIKey | HSENALUPARAQJF-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 426.59 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze bis(5-methyl-2-propan-2-ylcyclohexyl) 2,3-dihydroxybutanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(5-methyl-2-propan-2-ylcyclohexyl) 2,3-dihydroxybutanedioate?
The IUPAC name of bis(5-methyl-2-propan-2-ylcyclohexyl) 2,3-dihydroxybutanedioate (CID 558259) is bis(5-methyl-2-propan-2-ylcyclohexyl) 2,3-dihydroxybutanedioate.
What is the SMILES notation for bis(5-methyl-2-propan-2-ylcyclohexyl) 2,3-dihydroxybutanedioate?
The canonical SMILES for bis(5-methyl-2-propan-2-ylcyclohexyl) 2,3-dihydroxybutanedioate is CC1CCC(C(C)C)C(OC(=O)C(O)C(O)C(=O)OC2CC(C)CCC2C(C)C)C1.
What is the InChIKey of bis(5-methyl-2-propan-2-ylcyclohexyl) 2,3-dihydroxybutanedioate?
The InChIKey is HSENALUPARAQJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H42O6/c1-13(2)17-9-7-15(5)11-19(17)29-23(27)21(25)22(26)24(28)30-20-12-16(6)8-10-18(20)14(3)4/h13-22,25-26H,7-12H2,1-6H3.
What are the key properties of bis(5-methyl-2-propan-2-ylcyclohexyl) 2,3-dihydroxybutanedioate?
bis(5-methyl-2-propan-2-ylcyclohexyl) 2,3-dihydroxybutanedioate has a molecular weight of 426.59 g/mol, XLogP of 3.72, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(5-methyl-2-propan-2-ylcyclohexyl) 2,3-dihydroxybutanedioate is sourced from PubChem (CID 558259), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).