C19H21ClF2N2O3 — CID 55827232
N-[3-chloro-4-(difluoromethoxy)phenyl]-2-[cyclopentyl(furan-2-ylmethyl)amino]acetamide (PubChem CID 55827232) has the molecular formula C19H21ClF2N2O3 and a molecular weight of 398.84 g/mol. Its IUPAC name is N-[3-chloro-4-(difluoromethoxy)phenyl]-2-[cyclopentyl(furan-2-ylmethyl)amino]acetamide.
| Compound Name | N-[3-chloro-4-(difluoromethoxy)phenyl]-2-[cyclopentyl(furan-2-ylmethyl)amino]acetamide |
|---|---|
| PubChem CID | 55827232 |
| Molecular Formula | C19H21ClF2N2O3 |
| Molecular Weight | 398.84 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | N-[3-chloro-4-(difluoromethoxy)phenyl]-2-[cyclopentyl(furan-2-ylmethyl)amino]acetamide |
| SMILES | O=C(CN(Cc1ccco1)C1CCCC1)Nc1ccc(OC(F)F)c(Cl)c1 |
| InChI | InChI=1S/C19H21ClF2N2O3/c20-16-10-13(7-8-17(16)27-19(21)22)23-18(25)12-24(14-4-1-2-5-14)11-15-6-3-9-26-15/h3,6-10,14,19H,1-2,4-5,11-12H2,(H,23,25) |
| InChIKey | LHIJQAIQEKHXBK-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.84 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |