C13H13F3N6O3S — CID 55828528
1,1,1-trifluoro-2-(1-methylimidazol-2-yl)-4-[(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)amino]butan-2-ol (PubChem CID 55828528) has the molecular formula C13H13F3N6O3S and a molecular weight of 390.35 g/mol. Its IUPAC name is 1,1,1-trifluoro-2-(1-methylimidazol-2-yl)-4-[(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)amino]butan-2-ol.
| Compound Name | 1,1,1-trifluoro-2-(1-methylimidazol-2-yl)-4-[(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)amino]butan-2-ol |
|---|---|
| PubChem CID | 55828528 |
| Molecular Formula | C13H13F3N6O3S |
| Molecular Weight | 390.35 g/mol |
| Exact Mass | 390.07 |
| IUPAC Name | 1,1,1-trifluoro-2-(1-methylimidazol-2-yl)-4-[(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)amino]butan-2-ol |
| SMILES | Cn1ccnc1C(O)(CCNc1nc2sccn2c1[N+](=O)[O-])C(F)(F)F |
| InChI | InChI=1S/C13H13F3N6O3S/c1-20-5-4-18-10(20)12(23,13(14,15)16)2-3-17-8-9(22(24)25)21-6-7-26-11(21)19-8/h4-7,17,23H,2-3H2,1H3 |
| InChIKey | DZDDSRBFASXVEP-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.35 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|